C7H10OS — CID 10877220
(1R,5S)-8-thiabicyclo[3.2.1]octan-3-one (PubChem CID 10877220) has the molecular formula C7H10OS and a molecular weight of 142.22 g/mol. Its IUPAC name is (1R,5S)-8-thiabicyclo[3.2.1]octan-3-one.
| Compound Name | (1R,5S)-8-thiabicyclo[3.2.1]octan-3-one |
|---|---|
| PubChem CID | 10877220 |
| Molecular Formula | C7H10OS |
| Molecular Weight | 142.22 g/mol |
| Exact Mass | 142.05 |
| IUPAC Name | (1R,5S)-8-thiabicyclo[3.2.1]octan-3-one |
| SMILES | O=C1C[C@H]2CC[C@@H](C1)S2 |
| InChI | InChI=1S/C7H10OS/c8-5-3-6-1-2-7(4-5)9-6/h6-7H,1-4H2/t6-,7+ |
| InChIKey | WRKYCQOFEBORNV-KNVOCYPGSA-N |
| XLogP | 1.61 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.22 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |