C9H12F2OS — CID 171936955
4,4-difluoro-10-thiabicyclo[4.3.1]decan-3-one (PubChem CID 171936955) has the molecular formula C9H12F2OS and a molecular weight of 206.26 g/mol. Its IUPAC name is 4,4-difluoro-10-thiabicyclo[4.3.1]decan-3-one.
| Compound Name | 4,4-difluoro-10-thiabicyclo[4.3.1]decan-3-one |
|---|---|
| PubChem CID | 171936955 |
| Molecular Formula | C9H12F2OS |
| Molecular Weight | 206.26 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 4,4-difluoro-10-thiabicyclo[4.3.1]decan-3-one |
| SMILES | O=C1CC2CCCC(CC1(F)F)S2 |
| InChI | InChI=1S/C9H12F2OS/c10-9(11)5-7-3-1-2-6(13-7)4-8(9)12/h6-7H,1-5H2 |
| InChIKey | HZFQIUGYGCKCNL-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.26 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |