C15H28F3NO2 — CID 101153761
(2R,3R)-N,N-dibutyl-3-hydroxy-2-(trifluoromethyl)hexanamide (PubChem CID 101153761) has the molecular formula C15H28F3NO2 and a molecular weight of 311.39 g/mol. Its IUPAC name is (2R,3R)-N,N-dibutyl-3-hydroxy-2-(trifluoromethyl)hexanamide.
| Compound Name | (2R,3R)-N,N-dibutyl-3-hydroxy-2-(trifluoromethyl)hexanamide |
|---|---|
| PubChem CID | 101153761 |
| Molecular Formula | C15H28F3NO2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | (2R,3R)-N,N-dibutyl-3-hydroxy-2-(trifluoromethyl)hexanamide |
| SMILES | CCCCN(CCCC)C(=O)[C@@H]([C@H](O)CCC)C(F)(F)F |
| InChI | InChI=1S/C15H28F3NO2/c1-4-7-10-19(11-8-5-2)14(21)13(15(16,17)18)12(20)9-6-3/h12-13,20H,4-11H2,1-3H3/t12-,13-/m1/s1 |
| InChIKey | OPAGLOHKSNBAJU-CHWSQXEVSA-N |
| XLogP | 3.75 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |