C9H11F3O4 — CID 101154211
(3S)-3-(2,2,2-trifluoroethoxycarbonyl)hex-5-enoic acid (PubChem CID 101154211) has the molecular formula C9H11F3O4 and a molecular weight of 240.18 g/mol. Its IUPAC name is (3S)-3-(2,2,2-trifluoroethoxycarbonyl)hex-5-enoic acid.
| Compound Name | (3S)-3-(2,2,2-trifluoroethoxycarbonyl)hex-5-enoic acid |
|---|---|
| PubChem CID | 101154211 |
| Molecular Formula | C9H11F3O4 |
| Molecular Weight | 240.18 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | (3S)-3-(2,2,2-trifluoroethoxycarbonyl)hex-5-enoic acid |
| SMILES | C=CC[C@@H](CC(=O)O)C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C9H11F3O4/c1-2-3-6(4-7(13)14)8(15)16-5-9(10,11)12/h2,6H,1,3-5H2,(H,13,14)/t6-/m0/s1 |
| InChIKey | NLUPEPXGICOAJU-LURJTMIESA-N |
| XLogP | 1.76 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.18 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|