C12H17F3O4 — CID 58128302
4,4,4-trifluoro-2-(2-hex-5-enoxy-2-oxoethyl)butanoic acid (PubChem CID 58128302) has the molecular formula C12H17F3O4 and a molecular weight of 282.26 g/mol. Its IUPAC name is 4,4,4-trifluoro-2-(2-hex-5-enoxy-2-oxoethyl)butanoic acid.
| Compound Name | 4,4,4-trifluoro-2-(2-hex-5-enoxy-2-oxoethyl)butanoic acid |
|---|---|
| PubChem CID | 58128302 |
| Molecular Formula | C12H17F3O4 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 4,4,4-trifluoro-2-(2-hex-5-enoxy-2-oxoethyl)butanoic acid |
| SMILES | C=CCCCCOC(=O)CC(CC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C12H17F3O4/c1-2-3-4-5-6-19-10(16)7-9(11(17)18)8-12(13,14)15/h2,9H,1,3-8H2,(H,17,18) |
| InChIKey | SBGYIOMDCWCCLF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|