C14H21F3O4 — CID 58128341
6,6,6-trifluoro-2-(2-hex-5-enoxy-2-oxoethyl)hexanoic acid (PubChem CID 58128341) has the molecular formula C14H21F3O4 and a molecular weight of 310.31 g/mol. Its IUPAC name is 6,6,6-trifluoro-2-(2-hex-5-enoxy-2-oxoethyl)hexanoic acid.
| Compound Name | 6,6,6-trifluoro-2-(2-hex-5-enoxy-2-oxoethyl)hexanoic acid |
|---|---|
| PubChem CID | 58128341 |
| Molecular Formula | C14H21F3O4 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 6,6,6-trifluoro-2-(2-hex-5-enoxy-2-oxoethyl)hexanoic acid |
| SMILES | C=CCCCCOC(=O)CC(CCCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C14H21F3O4/c1-2-3-4-5-9-21-12(18)10-11(13(19)20)7-6-8-14(15,16)17/h2,11H,1,3-10H2,(H,19,20) |
| InChIKey | TZMZJPRYRYYLOI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|