C15H24F2O4 — CID 59148032
5,5-difluoro-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]non-8-enoic acid (PubChem CID 59148032) has the molecular formula C15H24F2O4 and a molecular weight of 306.35 g/mol. Its IUPAC name is 5,5-difluoro-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]non-8-enoic acid.
| Compound Name | 5,5-difluoro-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]non-8-enoic acid |
|---|---|
| PubChem CID | 59148032 |
| Molecular Formula | C15H24F2O4 |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 5,5-difluoro-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]non-8-enoic acid |
| SMILES | C=CCCC(F)(F)CCC(CC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C15H24F2O4/c1-5-6-8-15(16,17)9-7-11(13(19)20)10-12(18)21-14(2,3)4/h5,11H,1,6-10H2,2-4H3,(H,19,20) |
| InChIKey | DUONAMFKYUWWMV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|