C16H26F2O4 — CID 59148041
4-O-tert-butyl 1-O-methyl 2-(3,3-difluorohept-6-enyl)butanedioate (PubChem CID 59148041) has the molecular formula C16H26F2O4 and a molecular weight of 320.38 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-methyl 2-(3,3-difluorohept-6-enyl)butanedioate.
| Compound Name | 4-O-tert-butyl 1-O-methyl 2-(3,3-difluorohept-6-enyl)butanedioate |
|---|---|
| PubChem CID | 59148041 |
| Molecular Formula | C16H26F2O4 |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 4-O-tert-butyl 1-O-methyl 2-(3,3-difluorohept-6-enyl)butanedioate |
| SMILES | C=CCCC(F)(F)CCC(CC(=O)OC(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C16H26F2O4/c1-6-7-9-16(17,18)10-8-12(14(20)21-5)11-13(19)22-15(2,3)4/h6,12H,1,7-11H2,2-5H3 |
| InChIKey | GFWQBPSPRBJPIX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|