C15H25FO4 — CID 59148042
5-fluoro-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]non-8-enoic acid (PubChem CID 59148042) has the molecular formula C15H25FO4 and a molecular weight of 288.36 g/mol. Its IUPAC name is 5-fluoro-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]non-8-enoic acid.
| Compound Name | 5-fluoro-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]non-8-enoic acid |
|---|---|
| PubChem CID | 59148042 |
| Molecular Formula | C15H25FO4 |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 5-fluoro-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]non-8-enoic acid |
| SMILES | C=CCCC(F)CCC(CC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C15H25FO4/c1-5-6-7-12(16)9-8-11(14(18)19)10-13(17)20-15(2,3)4/h5,11-12H,1,6-10H2,2-4H3,(H,18,19) |
| InChIKey | LSCWIHWPRGRBMP-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|