C15H23F3O4 — CID 123537737
3-[(2-methylpropan-2-yl)oxycarbonyl]-2-(4,4,4-trifluorobutyl)hex-5-enoic acid (PubChem CID 123537737) has the molecular formula C15H23F3O4 and a molecular weight of 324.34 g/mol. Its IUPAC name is 3-[(2-methylpropan-2-yl)oxycarbonyl]-2-(4,4,4-trifluorobutyl)hex-5-enoic acid.
| Compound Name | 3-[(2-methylpropan-2-yl)oxycarbonyl]-2-(4,4,4-trifluorobutyl)hex-5-enoic acid |
|---|---|
| PubChem CID | 123537737 |
| Molecular Formula | C15H23F3O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 3-[(2-methylpropan-2-yl)oxycarbonyl]-2-(4,4,4-trifluorobutyl)hex-5-enoic acid |
| SMILES | C=CCC(C(=O)OC(C)(C)C)C(CCCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C15H23F3O4/c1-5-7-11(13(21)22-14(2,3)4)10(12(19)20)8-6-9-15(16,17)18/h5,10-11H,1,6-9H2,2-4H3,(H,19,20) |
| InChIKey | YQOZQNKPXVXSAC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|