About 2-dimethylarsanylaniline
2-dimethylarsanylaniline (PubChem CID 101154305) has the molecular formula C8H12AsN
and a molecular weight of 197.11 g/mol. Its IUPAC name is 2-dimethylarsanylaniline.
Molecular Properties
| Compound Name | 2-dimethylarsanylaniline |
| PubChem CID | 101154305 |
| Molecular Formula | C8H12AsN |
| Molecular Weight | 197.11 g/mol |
| Exact Mass | 197.02 |
| IUPAC Name | 2-dimethylarsanylaniline |
| SMILES | C[As](C)c1ccccc1N |
| InChI | InChI=1S/C8H12AsN/c1-9(2)7-5-3-4-6-8(7)10/h3-6H,10H2,1-2H3 |
| InChIKey | IUNZETKAJPNQNG-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.11 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-dimethylarsanylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-dimethylarsanylaniline?
The IUPAC name of 2-dimethylarsanylaniline (CID 101154305) is 2-dimethylarsanylaniline.
What is the SMILES notation for 2-dimethylarsanylaniline?
The canonical SMILES for 2-dimethylarsanylaniline is C[As](C)c1ccccc1N.
What is the InChIKey of 2-dimethylarsanylaniline?
The InChIKey is IUNZETKAJPNQNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12AsN/c1-9(2)7-5-3-4-6-8(7)10/h3-6H,10H2,1-2H3.
What are the key properties of 2-dimethylarsanylaniline?
2-dimethylarsanylaniline has a molecular weight of 197.11 g/mol, XLogP of 1.23, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-dimethylarsanylaniline is sourced from PubChem (CID 101154305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).