C12H12BrF3O — CID 101155856
(Z)-3-bromo-4-(4-ethylphenyl)-1,1,1-trifluorobut-3-en-2-ol (PubChem CID 101155856) has the molecular formula C12H12BrF3O and a molecular weight of 309.13 g/mol. Its IUPAC name is (Z)-3-bromo-4-(4-ethylphenyl)-1,1,1-trifluorobut-3-en-2-ol.
| Compound Name | (Z)-3-bromo-4-(4-ethylphenyl)-1,1,1-trifluorobut-3-en-2-ol |
|---|---|
| PubChem CID | 101155856 |
| Molecular Formula | C12H12BrF3O |
| Molecular Weight | 309.13 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | (Z)-3-bromo-4-(4-ethylphenyl)-1,1,1-trifluorobut-3-en-2-ol |
| SMILES | CCc1ccc(/C=C(\Br)C(O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H12BrF3O/c1-2-8-3-5-9(6-4-8)7-10(13)11(17)12(14,15)16/h3-7,11,17H,2H2,1H3/b10-7- |
| InChIKey | CQPGDXDWWCLUDX-YFHOEESVSA-N |
| XLogP | 3.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.13 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |