C14H16F3N3O5 — CID 101156758
diethyl 2-[3,3-dicyanopropyl-(2,2,2-trifluoroacetyl)amino]propanedioate (PubChem CID 101156758) has the molecular formula C14H16F3N3O5 and a molecular weight of 363.29 g/mol. Its IUPAC name is diethyl 2-[3,3-dicyanopropyl-(2,2,2-trifluoroacetyl)amino]propanedioate.
| Compound Name | diethyl 2-[3,3-dicyanopropyl-(2,2,2-trifluoroacetyl)amino]propanedioate |
|---|---|
| PubChem CID | 101156758 |
| Molecular Formula | C14H16F3N3O5 |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | diethyl 2-[3,3-dicyanopropyl-(2,2,2-trifluoroacetyl)amino]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)N(CCC(C#N)C#N)C(=O)C(F)(F)F |
| InChI | InChI=1S/C14H16F3N3O5/c1-3-24-11(21)10(12(22)25-4-2)20(13(23)14(15,16)17)6-5-9(7-18)8-19/h9-10H,3-6H2,1-2H3 |
| InChIKey | NYUDBRVFXBHJKB-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 120.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|