C16H19F3N2O — CID 134917005
N-benzyl-N-[(1R)-1-cyanohexyl]-2,2,2-trifluoroacetamide (PubChem CID 134917005) has the molecular formula C16H19F3N2O and a molecular weight of 312.33 g/mol. Its IUPAC name is N-benzyl-N-[(1R)-1-cyanohexyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-benzyl-N-[(1R)-1-cyanohexyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 134917005 |
| Molecular Formula | C16H19F3N2O |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | N-benzyl-N-[(1R)-1-cyanohexyl]-2,2,2-trifluoroacetamide |
| SMILES | CCCCC[C@H](C#N)N(Cc1ccccc1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C16H19F3N2O/c1-2-3-5-10-14(11-20)21(15(22)16(17,18)19)12-13-8-6-4-7-9-13/h4,6-9,14H,2-3,5,10,12H2,1H3/t14-/m1/s1 |
| InChIKey | PNNDNRXSMUCKHR-CQSZACIVSA-N |
| XLogP | 4.05 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|