C17H17F3N2O — CID 135070982
N-benzyl-N-[cyano(cyclohexen-1-yl)methyl]-2,2,2-trifluoroacetamide (PubChem CID 135070982) has the molecular formula C17H17F3N2O and a molecular weight of 322.33 g/mol. Its IUPAC name is N-benzyl-N-[cyano(cyclohexen-1-yl)methyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-benzyl-N-[cyano(cyclohexen-1-yl)methyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 135070982 |
| Molecular Formula | C17H17F3N2O |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | N-benzyl-N-[cyano(cyclohexen-1-yl)methyl]-2,2,2-trifluoroacetamide |
| SMILES | N#CC(C1=CCCCC1)N(Cc1ccccc1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C17H17F3N2O/c18-17(19,20)16(23)22(12-13-7-3-1-4-8-13)15(11-21)14-9-5-2-6-10-14/h1,3-4,7-9,15H,2,5-6,10,12H2 |
| InChIKey | IIKPPYSPAMYHKO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|