C10H8 — CID 101157074
(3E)-3,4-diethynylhexa-1,3,5-triene (PubChem CID 101157074) has the molecular formula C10H8 and a molecular weight of 128.17 g/mol. Its IUPAC name is (3E)-3,4-diethynylhexa-1,3,5-triene.
| Compound Name | (3E)-3,4-diethynylhexa-1,3,5-triene |
|---|---|
| PubChem CID | 101157074 |
| Molecular Formula | C10H8 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.06 |
| IUPAC Name | (3E)-3,4-diethynylhexa-1,3,5-triene |
| SMILES | C#C/C(C=C)=C(/C#C)C=C |
| InChI | InChI=1S/C10H8/c1-5-9(6-2)10(7-3)8-4/h1,3,6,8H,2,4H2/b10-9+ |
| InChIKey | FZEFRYVQAJPUFT-MDZDMXLPSA-N |
| XLogP | 1.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|