C11H14 — CID 134977984
(3Z)-3,4,7-trimethylocta-3,5,6-trien-1-yne (PubChem CID 134977984) has the molecular formula C11H14 and a molecular weight of 146.23 g/mol. Its IUPAC name is (3Z)-3,4,7-trimethylocta-3,5,6-trien-1-yne.
| Compound Name | (3Z)-3,4,7-trimethylocta-3,5,6-trien-1-yne |
|---|---|
| PubChem CID | 134977984 |
| Molecular Formula | C11H14 |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | (3Z)-3,4,7-trimethylocta-3,5,6-trien-1-yne |
| SMILES | C#C/C(C)=C(/C)C=C=C(C)C |
| InChI | InChI=1S/C11H14/c1-6-10(4)11(5)8-7-9(2)3/h1,8H,2-5H3/b11-10- |
| InChIKey | APGNGYJHMCYORX-KHPPLWFESA-N |
| XLogP | 3.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|