C6H11NO6 — CID 101158160
(3R,4S,5R,6S)-1,3,4,5-tetrahydroxy-6-(hydroxymethyl)piperidin-2-one (PubChem CID 101158160) has the molecular formula C6H11NO6 and a molecular weight of 193.16 g/mol. Its IUPAC name is (3R,4S,5R,6S)-1,3,4,5-tetrahydroxy-6-(hydroxymethyl)piperidin-2-one.
| Compound Name | (3R,4S,5R,6S)-1,3,4,5-tetrahydroxy-6-(hydroxymethyl)piperidin-2-one |
|---|---|
| PubChem CID | 101158160 |
| Molecular Formula | C6H11NO6 |
| Molecular Weight | 193.16 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | (3R,4S,5R,6S)-1,3,4,5-tetrahydroxy-6-(hydroxymethyl)piperidin-2-one |
| SMILES | O=C1[C@H](O)[C@@H](O)[C@H](O)[C@H](CO)N1O |
| InChI | InChI=1S/C6H11NO6/c8-1-2-3(9)4(10)5(11)6(12)7(2)13/h2-5,8-11,13H,1H2/t2-,3+,4-,5+/m0/s1 |
| InChIKey | HPDVKODANCVXAZ-SKNVOMKLSA-N |
| XLogP | -3.34 |
| TPSA | 121.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.16 |
| LogP ≤ 5 | -3.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|