C29H41NO4Si — CID 101158424
(4S)-4-benzyl-3-[[6-(1,4-dioxaspiro[4.5]dec-6-en-7-yl)hex-2-ynyl-dimethylsilyl]methyl]-5,5-dimethyl-1,3-oxazolidin-2-one (PubChem CID 101158424) has the molecular formula C29H41NO4Si and a molecular weight of 495.74 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[[6-(1,4-dioxaspiro[4.5]dec-6-en-7-yl)hex-2-ynyl-dimethylsilyl]methyl]-5,5-dimethyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[[6-(1,4-dioxaspiro[4.5]dec-6-en-7-yl)hex-2-ynyl-dimethylsilyl]methyl]-5,5-dimethyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 101158424 |
| Molecular Formula | C29H41NO4Si |
| Molecular Weight | 495.74 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | (4S)-4-benzyl-3-[[6-(1,4-dioxaspiro[4.5]dec-6-en-7-yl)hex-2-ynyl-dimethylsilyl]methyl]-5,5-dimethyl-1,3-oxazolidin-2-one |
| SMILES | CC1(C)OC(=O)N(C[Si](C)(C)CC#CCCCC2=CC3(CCC2)OCCO3)[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C29H41NO4Si/c1-28(2)26(21-24-13-9-7-10-14-24)30(27(31)34-28)23-35(3,4)20-11-6-5-8-15-25-16-12-17-29(22-25)32-18-19-33-29/h7,9-10,13-14,22,26H,5,8,12,15-21,23H2,1-4H3/t26-/m0/s1 |
| InChIKey | CKEVQJYIWSGVRE-SANMLTNESA-N |
| XLogP | 6.10 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.74 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|