C29H43NO4Si — CID 11634682
(4R)-4-benzyl-3-[2-[(3R)-8-tri(propan-2-yl)silyloct-1-en-7-yn-3-yl]oxyacetyl]-1,3-oxazolidin-2-one (PubChem CID 11634682) has the molecular formula C29H43NO4Si and a molecular weight of 497.75 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[2-[(3R)-8-tri(propan-2-yl)silyloct-1-en-7-yn-3-yl]oxyacetyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[2-[(3R)-8-tri(propan-2-yl)silyloct-1-en-7-yn-3-yl]oxyacetyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11634682 |
| Molecular Formula | C29H43NO4Si |
| Molecular Weight | 497.75 g/mol |
| Exact Mass | 497.30 |
| IUPAC Name | (4R)-4-benzyl-3-[2-[(3R)-8-tri(propan-2-yl)silyloct-1-en-7-yn-3-yl]oxyacetyl]-1,3-oxazolidin-2-one |
| SMILES | C=C[C@@H](CCCC#C[Si](C(C)C)(C(C)C)C(C)C)OCC(=O)N1C(=O)OC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C29H43NO4Si/c1-8-27(17-13-10-14-18-35(22(2)3,23(4)5)24(6)7)33-21-28(31)30-26(20-34-29(30)32)19-25-15-11-9-12-16-25/h8-9,11-12,15-16,22-24,26-27H,1,10,13,17,19-21H2,2-7H3/t26-,27+/m1/s1 |
| InChIKey | AKDCCPSPHMAJAR-SXOMAYOGSA-N |
| XLogP | 6.54 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.75 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|