C25H35NO4Si — CID 24755644
(4S)-4-benzyl-3-[(E,3S)-3-hydroxy-2,2,5-trimethyl-9-trimethylsilylnon-4-en-8-ynoyl]-1,3-oxazolidin-2-one (PubChem CID 24755644) has the molecular formula C25H35NO4Si and a molecular weight of 441.64 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(E,3S)-3-hydroxy-2,2,5-trimethyl-9-trimethylsilylnon-4-en-8-ynoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(E,3S)-3-hydroxy-2,2,5-trimethyl-9-trimethylsilylnon-4-en-8-ynoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 24755644 |
| Molecular Formula | C25H35NO4Si |
| Molecular Weight | 441.64 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | (4S)-4-benzyl-3-[(E,3S)-3-hydroxy-2,2,5-trimethyl-9-trimethylsilylnon-4-en-8-ynoyl]-1,3-oxazolidin-2-one |
| SMILES | C/C(=C\[C@H](O)C(C)(C)C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1)CCC#C[Si](C)(C)C |
| InChI | InChI=1S/C25H35NO4Si/c1-19(12-10-11-15-31(4,5)6)16-22(27)25(2,3)23(28)26-21(18-30-24(26)29)17-20-13-8-7-9-14-20/h7-9,13-14,16,21-22,27H,10,12,17-18H2,1-6H3/b19-16+/t21-,22-/m0/s1 |
| InChIKey | SSXVDDRJBVJFHS-MRTXAKHJSA-N |
| XLogP | 4.57 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.64 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|