C35H45NO4Si — CID 101158425
(4S)-3-[[6-(1,4-dioxaspiro[4.5]dec-6-en-7-yl)hex-2-ynyl-dimethylsilyl]methyl]-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 101158425) has the molecular formula C35H45NO4Si and a molecular weight of 571.83 g/mol. Its IUPAC name is (4S)-3-[[6-(1,4-dioxaspiro[4.5]dec-6-en-7-yl)hex-2-ynyl-dimethylsilyl]methyl]-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[[6-(1,4-dioxaspiro[4.5]dec-6-en-7-yl)hex-2-ynyl-dimethylsilyl]methyl]-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 101158425 |
| Molecular Formula | C35H45NO4Si |
| Molecular Weight | 571.83 g/mol |
| Exact Mass | 571.31 |
| IUPAC Name | (4S)-3-[[6-(1,4-dioxaspiro[4.5]dec-6-en-7-yl)hex-2-ynyl-dimethylsilyl]methyl]-5,5-diphenyl-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | CC(C)[C@@H]1N(C[Si](C)(C)CC#CCCCC2=CC3(CCC2)OCCO3)C(=O)OC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H45NO4Si/c1-28(2)32-35(30-18-10-7-11-19-30,31-20-12-8-13-21-31)40-33(37)36(32)27-41(3,4)25-14-6-5-9-16-29-17-15-22-34(26-29)38-23-24-39-34/h7-8,10-13,18-21,26,28,32H,5,9,15-17,22-25,27H2,1-4H3/t32-/m0/s1 |
| InChIKey | SVAAVBOSXDGIHR-YTTGMZPUSA-N |
| XLogP | 7.68 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.83 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|