C38H53NO4S — CID 59850503
(E)-1-[(4S)-5,5-diphenyl-4-propan-2-yl-2-sulfanylidene-1,3-oxazolidin-3-yl]-10-(2-heptyl-1,3-dioxolan-2-yl)dec-3-en-1-one (PubChem CID 59850503) has the molecular formula C38H53NO4S and a molecular weight of 619.91 g/mol. Its IUPAC name is (E)-1-[(4S)-5,5-diphenyl-4-propan-2-yl-2-sulfanylidene-1,3-oxazolidin-3-yl]-10-(2-heptyl-1,3-dioxolan-2-yl)dec-3-en-1-one.
| Compound Name | (E)-1-[(4S)-5,5-diphenyl-4-propan-2-yl-2-sulfanylidene-1,3-oxazolidin-3-yl]-10-(2-heptyl-1,3-dioxolan-2-yl)dec-3-en-1-one |
|---|---|
| PubChem CID | 59850503 |
| Molecular Formula | C38H53NO4S |
| Molecular Weight | 619.91 g/mol |
| Exact Mass | 619.37 |
| IUPAC Name | (E)-1-[(4S)-5,5-diphenyl-4-propan-2-yl-2-sulfanylidene-1,3-oxazolidin-3-yl]-10-(2-heptyl-1,3-dioxolan-2-yl)dec-3-en-1-one |
| SMILES | CCCCCCCC1(CCCCCC/C=C/CC(=O)N2C(=S)OC(c3ccccc3)(c3ccccc3)[C@@H]2C(C)C)OCCO1 |
| InChI | InChI=1S/C38H53NO4S/c1-4-5-6-11-20-27-37(41-29-30-42-37)28-21-12-9-7-8-10-19-26-34(40)39-35(31(2)3)38(43-36(39)44,32-22-15-13-16-23-32)33-24-17-14-18-25-33/h10,13-19,22-25,31,35H,4-9,11-12,20-21,26-30H2,1-3H3/b19-10+/t35-/m0/s1 |
| InChIKey | LKUFVEDKIAANFK-FSGZAOGXSA-N |
| XLogP | 9.49 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.91 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|