C27H43NO4 — CID 10741995
N-[1-phenoxy-4-[2-[(5E,7E)-tetradeca-5,7-dienyl]-1,3-dioxolan-2-yl]butan-2-yl]hydroxylamine (PubChem CID 10741995) has the molecular formula C27H43NO4 and a molecular weight of 445.64 g/mol. Its IUPAC name is N-[1-phenoxy-4-[2-[(5E,7E)-tetradeca-5,7-dienyl]-1,3-dioxolan-2-yl]butan-2-yl]hydroxylamine.
| Compound Name | N-[1-phenoxy-4-[2-[(5E,7E)-tetradeca-5,7-dienyl]-1,3-dioxolan-2-yl]butan-2-yl]hydroxylamine |
|---|---|
| PubChem CID | 10741995 |
| Molecular Formula | C27H43NO4 |
| Molecular Weight | 445.64 g/mol |
| Exact Mass | 445.32 |
| IUPAC Name | N-[1-phenoxy-4-[2-[(5E,7E)-tetradeca-5,7-dienyl]-1,3-dioxolan-2-yl]butan-2-yl]hydroxylamine |
| SMILES | CCCCCC/C=C/C=C/CCCCC1(CCC(COc2ccccc2)NO)OCCO1 |
| InChI | InChI=1S/C27H43NO4/c1-2-3-4-5-6-7-8-9-10-11-12-16-20-27(31-22-23-32-27)21-19-25(28-29)24-30-26-17-14-13-15-18-26/h7-10,13-15,17-18,25,28-29H,2-6,11-12,16,19-24H2,1H3/b8-7+,10-9+ |
| InChIKey | FYEUQTFLJNBFMD-XBLVEGMJSA-N |
| XLogP | 6.58 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.64 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|