C41H59NO5S2 — CID 118157350
(E,2S,3S)-2-butyl-3-[(4S)-5,5-diphenyl-4-propan-2-yl-2-sulfanylidene-1,3-oxazolidine-3-carbonyl]-11-heptylsulfanyl-2-hydroxyundec-4-enoic acid (PubChem CID 118157350) has the molecular formula C41H59NO5S2 and a molecular weight of 710.06 g/mol. Its IUPAC name is (E,2S,3S)-2-butyl-3-[(4S)-5,5-diphenyl-4-propan-2-yl-2-sulfanylidene-1,3-oxazolidine-3-carbonyl]-11-heptylsulfanyl-2-hydroxyundec-4-enoic acid.
| Compound Name | (E,2S,3S)-2-butyl-3-[(4S)-5,5-diphenyl-4-propan-2-yl-2-sulfanylidene-1,3-oxazolidine-3-carbonyl]-11-heptylsulfanyl-2-hydroxyundec-4-enoic acid |
|---|---|
| PubChem CID | 118157350 |
| Molecular Formula | C41H59NO5S2 |
| Molecular Weight | 710.06 g/mol |
| Exact Mass | 709.38 |
| IUPAC Name | (E,2S,3S)-2-butyl-3-[(4S)-5,5-diphenyl-4-propan-2-yl-2-sulfanylidene-1,3-oxazolidine-3-carbonyl]-11-heptylsulfanyl-2-hydroxyundec-4-enoic acid |
| SMILES | CCCCCCCSCCCCCC/C=C/[C@H](C(=O)N1C(=S)OC(c2ccccc2)(c2ccccc2)[C@@H]1C(C)C)[C@@](O)(CCCC)C(=O)O |
| InChI | InChI=1S/C41H59NO5S2/c1-5-7-9-13-22-30-49-31-23-14-11-10-12-21-28-35(40(46,38(44)45)29-8-6-2)37(43)42-36(32(3)4)41(47-39(42)48,33-24-17-15-18-25-33)34-26-19-16-20-27-34/h15-21,24-28,32,35-36,46H,5-14,22-23,29-31H2,1-4H3,(H,44,45)/b28-21+/t35-,36+,40+/m1/s1 |
| InChIKey | QPCOUJBUGBOKDU-WNSQQDEGSA-N |
| XLogP | 9.93 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.06 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|