C40H57NO5S2 — CID 118157659
(E,2S,3S)-3-[(4S)-5,5-diphenyl-4-propan-2-yl-2-sulfanylidene-1,3-oxazolidine-3-carbonyl]-11-heptylsulfanyl-2-hydroxy-2-propylundec-4-enoic acid (PubChem CID 118157659) has the molecular formula C40H57NO5S2 and a molecular weight of 696.03 g/mol. Its IUPAC name is (E,2S,3S)-3-[(4S)-5,5-diphenyl-4-propan-2-yl-2-sulfanylidene-1,3-oxazolidine-3-carbonyl]-11-heptylsulfanyl-2-hydroxy-2-propylundec-4-enoic acid.
| Compound Name | (E,2S,3S)-3-[(4S)-5,5-diphenyl-4-propan-2-yl-2-sulfanylidene-1,3-oxazolidine-3-carbonyl]-11-heptylsulfanyl-2-hydroxy-2-propylundec-4-enoic acid |
|---|---|
| PubChem CID | 118157659 |
| Molecular Formula | C40H57NO5S2 |
| Molecular Weight | 696.03 g/mol |
| Exact Mass | 695.37 |
| IUPAC Name | (E,2S,3S)-3-[(4S)-5,5-diphenyl-4-propan-2-yl-2-sulfanylidene-1,3-oxazolidine-3-carbonyl]-11-heptylsulfanyl-2-hydroxy-2-propylundec-4-enoic acid |
| SMILES | CCCCCCCSCCCCCC/C=C/[C@H](C(=O)N1C(=S)OC(c2ccccc2)(c2ccccc2)[C@@H]1C(C)C)[C@@](O)(CCC)C(=O)O |
| InChI | InChI=1S/C40H57NO5S2/c1-5-7-8-12-21-29-48-30-22-13-10-9-11-20-27-34(39(45,28-6-2)37(43)44)36(42)41-35(31(3)4)40(46-38(41)47,32-23-16-14-17-24-32)33-25-18-15-19-26-33/h14-20,23-27,31,34-35,45H,5-13,21-22,28-30H2,1-4H3,(H,43,44)/b27-20+/t34-,35+,39+/m1/s1 |
| InChIKey | QWKXNRDHZSQNST-PPHWRJJQSA-N |
| XLogP | 9.54 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.03 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|