C10H12O6 — CID 101158451
2-(2-methylprop-2-enoyloxy)ethyl (2R)-4-oxooxetane-2-carboxylate (PubChem CID 101158451) has the molecular formula C10H12O6 and a molecular weight of 228.20 g/mol. Its IUPAC name is 2-(2-methylprop-2-enoyloxy)ethyl (2R)-4-oxooxetane-2-carboxylate.
| Compound Name | 2-(2-methylprop-2-enoyloxy)ethyl (2R)-4-oxooxetane-2-carboxylate |
|---|---|
| PubChem CID | 101158451 |
| Molecular Formula | C10H12O6 |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 2-(2-methylprop-2-enoyloxy)ethyl (2R)-4-oxooxetane-2-carboxylate |
| SMILES | C=C(C)C(=O)OCCOC(=O)[C@H]1CC(=O)O1 |
| InChI | InChI=1S/C10H12O6/c1-6(2)9(12)14-3-4-15-10(13)7-5-8(11)16-7/h7H,1,3-5H2,2H3/t7-/m1/s1 |
| InChIKey | FZDJPSNGMRPVKX-SSDOTTSWSA-N |
| XLogP | -0.04 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|