C30H20F8N2O2 — CID 101158900
6-methyl-3-[2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-(6-methyl-2,4-dihydro-1,3-benzoxazin-3-yl)phenyl]phenyl]-2,4-dihydro-1,3-benzoxazine (PubChem CID 101158900) has the molecular formula C30H20F8N2O2 and a molecular weight of 592.49 g/mol. Its IUPAC name is 6-methyl-3-[2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-(6-methyl-2,4-dihydro-1,3-benzoxazin-3-yl)phenyl]phenyl]-2,4-dihydro-1,3-benzoxazine.
| Compound Name | 6-methyl-3-[2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-(6-methyl-2,4-dihydro-1,3-benzoxazin-3-yl)phenyl]phenyl]-2,4-dihydro-1,3-benzoxazine |
|---|---|
| PubChem CID | 101158900 |
| Molecular Formula | C30H20F8N2O2 |
| Molecular Weight | 592.49 g/mol |
| Exact Mass | 592.14 |
| IUPAC Name | 6-methyl-3-[2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-(6-methyl-2,4-dihydro-1,3-benzoxazin-3-yl)phenyl]phenyl]-2,4-dihydro-1,3-benzoxazine |
| SMILES | Cc1ccc2c(c1)CN(c1c(F)c(F)c(-c3c(F)c(F)c(N4COc5ccc(C)cc5C4)c(F)c3F)c(F)c1F)CO2 |
| InChI | InChI=1S/C30H20F8N2O2/c1-13-3-5-17-15(7-13)9-39(11-41-17)29-25(35)21(31)19(22(32)26(29)36)20-23(33)27(37)30(28(38)24(20)34)40-10-16-8-14(2)4-6-18(16)42-12-40/h3-8H,9-12H2,1-2H3 |
| InChIKey | IYBJRSIFORLRMF-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.49 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|