C31H34NO3+ — CID 10116007
[2-(4-methoxyphenyl)-3,4-dihydronaphthalen-1-yl]-[4-[2-(1-methylpyrrolidin-1-ium-1-yl)ethoxy]phenyl]methanone (PubChem CID 10116007) has the molecular formula C31H34NO3+ and a molecular weight of 468.62 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-3,4-dihydronaphthalen-1-yl]-[4-[2-(1-methylpyrrolidin-1-ium-1-yl)ethoxy]phenyl]methanone.
| Compound Name | [2-(4-methoxyphenyl)-3,4-dihydronaphthalen-1-yl]-[4-[2-(1-methylpyrrolidin-1-ium-1-yl)ethoxy]phenyl]methanone |
|---|---|
| PubChem CID | 10116007 |
| Molecular Formula | C31H34NO3+ |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | [2-(4-methoxyphenyl)-3,4-dihydronaphthalen-1-yl]-[4-[2-(1-methylpyrrolidin-1-ium-1-yl)ethoxy]phenyl]methanone |
| SMILES | COc1ccc(C2=C(C(=O)c3ccc(OCC[N+]4(C)CCCC4)cc3)c3ccccc3CC2)cc1 |
| InChI | InChI=1S/C31H34NO3/c1-32(19-5-6-20-32)21-22-35-27-16-11-25(12-17-27)31(33)30-28-8-4-3-7-23(28)13-18-29(30)24-9-14-26(34-2)15-10-24/h3-4,7-12,14-17H,5-6,13,18-22H2,1-2H3/q+1 |
| InChIKey | IVUMUAWUGHDCNX-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|