C35H41NO3 — CID 56981705
[4-(2-hexyliminoethoxy)phenyl]-[2-[4-[(2-methylpropan-2-yl)oxy]phenyl]-3,4-dihydronaphthalen-1-yl]methanone (PubChem CID 56981705) has the molecular formula C35H41NO3 and a molecular weight of 523.72 g/mol. Its IUPAC name is [4-(2-hexyliminoethoxy)phenyl]-[2-[4-[(2-methylpropan-2-yl)oxy]phenyl]-3,4-dihydronaphthalen-1-yl]methanone.
| Compound Name | [4-(2-hexyliminoethoxy)phenyl]-[2-[4-[(2-methylpropan-2-yl)oxy]phenyl]-3,4-dihydronaphthalen-1-yl]methanone |
|---|---|
| PubChem CID | 56981705 |
| Molecular Formula | C35H41NO3 |
| Molecular Weight | 523.72 g/mol |
| Exact Mass | 523.31 |
| IUPAC Name | [4-(2-hexyliminoethoxy)phenyl]-[2-[4-[(2-methylpropan-2-yl)oxy]phenyl]-3,4-dihydronaphthalen-1-yl]methanone |
| SMILES | CCCCCC/N=C/COc1ccc(C(=O)C2=C(c3ccc(OC(C)(C)C)cc3)CCc3ccccc32)cc1 |
| InChI | InChI=1S/C35H41NO3/c1-5-6-7-10-23-36-24-25-38-29-18-15-28(16-19-29)34(37)33-31-12-9-8-11-26(31)17-22-32(33)27-13-20-30(21-14-27)39-35(2,3)4/h8-9,11-16,18-21,24H,5-7,10,17,22-23,25H2,1-4H3/b36-24+ |
| InChIKey | BFYVHBUINLWOLB-XBQJKBNESA-N |
| XLogP | 8.63 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.72 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|