C27H25BrO4 — CID 18182638
[4-(2-bromoethoxy)phenyl]-[6-methoxy-2-(2-methoxyphenyl)-3,4-dihydronaphthalen-1-yl]methanone (PubChem CID 18182638) has the molecular formula C27H25BrO4 and a molecular weight of 493.40 g/mol. Its IUPAC name is [4-(2-bromoethoxy)phenyl]-[6-methoxy-2-(2-methoxyphenyl)-3,4-dihydronaphthalen-1-yl]methanone.
| Compound Name | [4-(2-bromoethoxy)phenyl]-[6-methoxy-2-(2-methoxyphenyl)-3,4-dihydronaphthalen-1-yl]methanone |
|---|---|
| PubChem CID | 18182638 |
| Molecular Formula | C27H25BrO4 |
| Molecular Weight | 493.40 g/mol |
| Exact Mass | 492.09 |
| IUPAC Name | [4-(2-bromoethoxy)phenyl]-[6-methoxy-2-(2-methoxyphenyl)-3,4-dihydronaphthalen-1-yl]methanone |
| SMILES | COc1ccc2c(c1)CCC(c1ccccc1OC)=C2C(=O)c1ccc(OCCBr)cc1 |
| InChI | InChI=1S/C27H25BrO4/c1-30-21-12-14-22-19(17-21)9-13-24(23-5-3-4-6-25(23)31-2)26(22)27(29)18-7-10-20(11-8-18)32-16-15-28/h3-8,10-12,14,17H,9,13,15-16H2,1-2H3 |
| InChIKey | QOXZSHQHPNLXEA-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.40 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|