C31H27O6P — CID 20648494
[1-(4-methoxybenzoyl)-6-methyl-3,4-dihydronaphthalen-2-yl] diphenyl phosphate (PubChem CID 20648494) has the molecular formula C31H27O6P and a molecular weight of 526.53 g/mol. Its IUPAC name is [1-(4-methoxybenzoyl)-6-methyl-3,4-dihydronaphthalen-2-yl] diphenyl phosphate.
| Compound Name | [1-(4-methoxybenzoyl)-6-methyl-3,4-dihydronaphthalen-2-yl] diphenyl phosphate |
|---|---|
| PubChem CID | 20648494 |
| Molecular Formula | C31H27O6P |
| Molecular Weight | 526.53 g/mol |
| Exact Mass | 526.15 |
| IUPAC Name | [1-(4-methoxybenzoyl)-6-methyl-3,4-dihydronaphthalen-2-yl] diphenyl phosphate |
| SMILES | COc1ccc(C(=O)C2=C(OP(=O)(Oc3ccccc3)Oc3ccccc3)CCc3cc(C)ccc32)cc1 |
| InChI | InChI=1S/C31H27O6P/c1-22-13-19-28-24(21-22)16-20-29(30(28)31(32)23-14-17-25(34-2)18-15-23)37-38(33,35-26-9-5-3-6-10-26)36-27-11-7-4-8-12-27/h3-15,17-19,21H,16,20H2,1-2H3 |
| InChIKey | UUUWUXZELOQXEF-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.53 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|