C36H43FN2O4 — CID 177266511
tert-butyl 4-[4-[6-butoxy-2-(2-fluorophenyl)-3,4-dihydronaphthalen-1-yl]-3-methoxyphenyl]piperazine-1-carboxylate (PubChem CID 177266511) has the molecular formula C36H43FN2O4 and a molecular weight of 586.75 g/mol. Its IUPAC name is tert-butyl 4-[4-[6-butoxy-2-(2-fluorophenyl)-3,4-dihydronaphthalen-1-yl]-3-methoxyphenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[6-butoxy-2-(2-fluorophenyl)-3,4-dihydronaphthalen-1-yl]-3-methoxyphenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 177266511 |
| Molecular Formula | C36H43FN2O4 |
| Molecular Weight | 586.75 g/mol |
| Exact Mass | 586.32 |
| IUPAC Name | tert-butyl 4-[4-[6-butoxy-2-(2-fluorophenyl)-3,4-dihydronaphthalen-1-yl]-3-methoxyphenyl]piperazine-1-carboxylate |
| SMILES | CCCCOc1ccc2c(c1)CCC(c1ccccc1F)=C2c1ccc(N2CCN(C(=O)OC(C)(C)C)CC2)cc1OC |
| InChI | InChI=1S/C36H43FN2O4/c1-6-7-22-42-27-14-17-28-25(23-27)12-15-30(29-10-8-9-11-32(29)37)34(28)31-16-13-26(24-33(31)41-5)38-18-20-39(21-19-38)35(40)43-36(2,3)4/h8-11,13-14,16-17,23-24H,6-7,12,15,18-22H2,1-5H3 |
| InChIKey | UCGORIZZJMFJFS-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.75 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|