C7H12N4 — CID 101163533
(4R)-1-butyl-4,5-dihydrotriazole-4-carbonitrile (PubChem CID 101163533) has the molecular formula C7H12N4 and a molecular weight of 152.20 g/mol. Its IUPAC name is (4R)-1-butyl-4,5-dihydrotriazole-4-carbonitrile.
| Compound Name | (4R)-1-butyl-4,5-dihydrotriazole-4-carbonitrile |
|---|---|
| PubChem CID | 101163533 |
| Molecular Formula | C7H12N4 |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.11 |
| IUPAC Name | (4R)-1-butyl-4,5-dihydrotriazole-4-carbonitrile |
| SMILES | CCCCN1C[C@H](C#N)N=N1 |
| InChI | InChI=1S/C7H12N4/c1-2-3-4-11-6-7(5-8)9-10-11/h7H,2-4,6H2,1H3/t7-/m0/s1 |
| InChIKey | HRFUDEXSCXXVNE-ZETCQYMHSA-N |
| XLogP | 1.36 |
| TPSA | 51.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |