About pyrrole-1-carbonitrile;tetrabutylphosphanium
pyrrole-1-carbonitrile;tetrabutylphosphanium (PubChem CID 122585432) has the molecular formula C21H40N2P+
and a molecular weight of 351.54 g/mol. Its IUPAC name is pyrrole-1-carbonitrile;tetrabutylphosphanium.
Molecular Properties
| Compound Name | pyrrole-1-carbonitrile;tetrabutylphosphanium |
| PubChem CID | 122585432 |
| Molecular Formula | C21H40N2P+ |
| Molecular Weight | 351.54 g/mol |
| Exact Mass | 351.29 |
| IUPAC Name | pyrrole-1-carbonitrile;tetrabutylphosphanium |
| SMILES | CCCC[P+](CCCC)(CCCC)CCCC.N#Cn1cccc1 |
| InChI | InChI=1S/C16H36P.C5H4N2/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;6-5-7-3-1-2-4-7/h5-16H2,1-4H3;1-4H/q+1; |
| InChIKey | JXRNVLORDOQCKH-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.54 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze pyrrole-1-carbonitrile;tetrabutylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrole-1-carbonitrile;tetrabutylphosphanium?
The IUPAC name of pyrrole-1-carbonitrile;tetrabutylphosphanium (CID 122585432) is pyrrole-1-carbonitrile;tetrabutylphosphanium.
What is the SMILES notation for pyrrole-1-carbonitrile;tetrabutylphosphanium?
The canonical SMILES for pyrrole-1-carbonitrile;tetrabutylphosphanium is CCCC[P+](CCCC)(CCCC)CCCC.N#Cn1cccc1.
What is the InChIKey of pyrrole-1-carbonitrile;tetrabutylphosphanium?
The InChIKey is JXRNVLORDOQCKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H36P.C5H4N2/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;6-5-7-3-1-2-4-7/h5-16H2,1-4H3;1-4H/q+1;.
What are the key properties of pyrrole-1-carbonitrile;tetrabutylphosphanium?
pyrrole-1-carbonitrile;tetrabutylphosphanium has a molecular weight of 351.54 g/mol, XLogP of 7.02, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrole-1-carbonitrile;tetrabutylphosphanium is sourced from PubChem (CID 122585432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).