C24H20O4S2 — CID 101164694
(1E,6E)-4-(1,3-dithiol-2-ylidene)-1,7-bis(3-methoxyphenyl)hepta-1,6-diene-3,5-dione (PubChem CID 101164694) has the molecular formula C24H20O4S2 and a molecular weight of 436.55 g/mol. Its IUPAC name is (1E,6E)-4-(1,3-dithiol-2-ylidene)-1,7-bis(3-methoxyphenyl)hepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-4-(1,3-dithiol-2-ylidene)-1,7-bis(3-methoxyphenyl)hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 101164694 |
| Molecular Formula | C24H20O4S2 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | (1E,6E)-4-(1,3-dithiol-2-ylidene)-1,7-bis(3-methoxyphenyl)hepta-1,6-diene-3,5-dione |
| SMILES | COc1cccc(/C=C/C(=O)C(C(=O)/C=C/c2cccc(OC)c2)=C2SC=CS2)c1 |
| InChI | InChI=1S/C24H20O4S2/c1-27-19-7-3-5-17(15-19)9-11-21(25)23(24-29-13-14-30-24)22(26)12-10-18-6-4-8-20(16-18)28-2/h3-16H,1-2H3/b11-9+,12-10+ |
| InChIKey | YYZFSPHYNLHKNY-WGDLNXRISA-N |
| XLogP | 5.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|