C40H36O8S2 — CID 162372493
(1E,6E)-1,7-bis(3,5-dimethoxy-4-phenylmethoxyphenyl)-4-(1,3-dithiol-2-ylidene)hepta-1,6-diene-3,5-dione (PubChem CID 162372493) has the molecular formula C40H36O8S2 and a molecular weight of 708.85 g/mol. Its IUPAC name is (1E,6E)-1,7-bis(3,5-dimethoxy-4-phenylmethoxyphenyl)-4-(1,3-dithiol-2-ylidene)hepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-1,7-bis(3,5-dimethoxy-4-phenylmethoxyphenyl)-4-(1,3-dithiol-2-ylidene)hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 162372493 |
| Molecular Formula | C40H36O8S2 |
| Molecular Weight | 708.85 g/mol |
| Exact Mass | 708.19 |
| IUPAC Name | (1E,6E)-1,7-bis(3,5-dimethoxy-4-phenylmethoxyphenyl)-4-(1,3-dithiol-2-ylidene)hepta-1,6-diene-3,5-dione |
| SMILES | COc1cc(/C=C/C(=O)C(C(=O)/C=C/c2cc(OC)c(OCc3ccccc3)c(OC)c2)=C2SC=CS2)cc(OC)c1OCc1ccccc1 |
| InChI | InChI=1S/C40H36O8S2/c1-43-33-21-29(22-34(44-2)38(33)47-25-27-11-7-5-8-12-27)15-17-31(41)37(40-49-19-20-50-40)32(42)18-16-30-23-35(45-3)39(36(24-30)46-4)48-26-28-13-9-6-10-14-28/h5-24H,25-26H2,1-4H3/b17-15+,18-16+ |
| InChIKey | JHWUJEZRRLDYHJ-YTEMWHBBSA-N |
| XLogP | 8.91 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.85 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|