C21H32O5 — CID 101165614
2-[(4'aR,4'bR,8'aR,10'aS)-4'a-(1,3-dioxolan-2-yl)spiro[1,3-dioxolane-2,1'-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthrene]-8'a-yl]ethanol (PubChem CID 101165614) has the molecular formula C21H32O5 and a molecular weight of 364.48 g/mol. Its IUPAC name is 2-[(4'aR,4'bR,8'aR,10'aS)-4'a-(1,3-dioxolan-2-yl)spiro[1,3-dioxolane-2,1'-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthrene]-8'a-yl]ethanol.
| Compound Name | 2-[(4'aR,4'bR,8'aR,10'aS)-4'a-(1,3-dioxolan-2-yl)spiro[1,3-dioxolane-2,1'-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthrene]-8'a-yl]ethanol |
|---|---|
| PubChem CID | 101165614 |
| Molecular Formula | C21H32O5 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 2-[(4'aR,4'bR,8'aR,10'aS)-4'a-(1,3-dioxolan-2-yl)spiro[1,3-dioxolane-2,1'-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthrene]-8'a-yl]ethanol |
| SMILES | OCC[C@]12C=CCC[C@H]1[C@]1(C3OCCO3)CCCC3(OCCO3)[C@H]1CC2 |
| InChI | InChI=1S/C21H32O5/c22-11-10-19-6-2-1-4-16(19)20(18-23-12-13-24-18)7-3-8-21(17(20)5-9-19)25-14-15-26-21/h2,6,16-18,22H,1,3-5,7-15H2/t16-,17+,19-,20-/m1/s1 |
| InChIKey | GUVGESMYCLAGBJ-PIKOESSRSA-N |
| XLogP | 3.02 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|