C21H25N2OP — CID 101166330
[(2S)-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)pyrrolidin-1-yl]-diphenylphosphane (PubChem CID 101166330) has the molecular formula C21H25N2OP and a molecular weight of 352.42 g/mol. Its IUPAC name is [(2S)-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)pyrrolidin-1-yl]-diphenylphosphane.
| Compound Name | [(2S)-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)pyrrolidin-1-yl]-diphenylphosphane |
|---|---|
| PubChem CID | 101166330 |
| Molecular Formula | C21H25N2OP |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | [(2S)-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)pyrrolidin-1-yl]-diphenylphosphane |
| SMILES | CC1(C)COC([C@@H]2CCCN2P(c2ccccc2)c2ccccc2)=N1 |
| InChI | InChI=1S/C21H25N2OP/c1-21(2)16-24-20(22-21)19-14-9-15-23(19)25(17-10-5-3-6-11-17)18-12-7-4-8-13-18/h3-8,10-13,19H,9,14-16H2,1-2H3/t19-/m0/s1 |
| InChIKey | MDKZDNBRPLWTNA-IBGZPJMESA-N |
| XLogP | 3.71 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|