C26H33N2O3PS — CID 23420297
tert-butyl (2S,4S)-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-4-diphenylphosphinothioylpyrrolidine-1-carboxylate (PubChem CID 23420297) has the molecular formula C26H33N2O3PS and a molecular weight of 484.60 g/mol. Its IUPAC name is tert-butyl (2S,4S)-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-4-diphenylphosphinothioylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4S)-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-4-diphenylphosphinothioylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 23420297 |
| Molecular Formula | C26H33N2O3PS |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | tert-butyl (2S,4S)-2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-4-diphenylphosphinothioylpyrrolidine-1-carboxylate |
| SMILES | CC1(C)COC([C@@H]2C[C@H](P(=S)(c3ccccc3)c3ccccc3)CN2C(=O)OC(C)(C)C)=N1 |
| InChI | InChI=1S/C26H33N2O3PS/c1-25(2,3)31-24(29)28-17-21(16-22(28)23-27-26(4,5)18-30-23)32(33,19-12-8-6-9-13-19)20-14-10-7-11-15-20/h6-15,21-22H,16-18H2,1-5H3/t21-,22-/m0/s1 |
| InChIKey | YCGMPHXDIGNYJZ-VXKWHMMOSA-N |
| XLogP | 4.70 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|