C24H32NO3P — CID 12036823
tert-butyl (4S)-4-(2-diphenylphosphanylethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 12036823) has the molecular formula C24H32NO3P and a molecular weight of 413.50 g/mol. Its IUPAC name is tert-butyl (4S)-4-(2-diphenylphosphanylethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-4-(2-diphenylphosphanylethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 12036823 |
| Molecular Formula | C24H32NO3P |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | tert-butyl (4S)-4-(2-diphenylphosphanylethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](CCP(c2ccccc2)c2ccccc2)COC1(C)C |
| InChI | InChI=1S/C24H32NO3P/c1-23(2,3)28-22(26)25-19(18-27-24(25,4)5)16-17-29(20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-15,19H,16-18H2,1-5H3/t19-/m0/s1 |
| InChIKey | IQYAPCAQUQKIKH-IBGZPJMESA-N |
| XLogP | 4.88 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|