C20H26INO — CID 101167095
(E)-5-iodo-1-[(1R,2S,3S,5S)-8-methyl-3-(4-methylphenyl)-8-azabicyclo[3.2.1]octan-2-yl]pent-4-en-1-one (PubChem CID 101167095) has the molecular formula C20H26INO and a molecular weight of 423.34 g/mol. Its IUPAC name is (E)-5-iodo-1-[(1R,2S,3S,5S)-8-methyl-3-(4-methylphenyl)-8-azabicyclo[3.2.1]octan-2-yl]pent-4-en-1-one.
| Compound Name | (E)-5-iodo-1-[(1R,2S,3S,5S)-8-methyl-3-(4-methylphenyl)-8-azabicyclo[3.2.1]octan-2-yl]pent-4-en-1-one |
|---|---|
| PubChem CID | 101167095 |
| Molecular Formula | C20H26INO |
| Molecular Weight | 423.34 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | (E)-5-iodo-1-[(1R,2S,3S,5S)-8-methyl-3-(4-methylphenyl)-8-azabicyclo[3.2.1]octan-2-yl]pent-4-en-1-one |
| SMILES | Cc1ccc([C@H]2C[C@@H]3CC[C@H]([C@H]2C(=O)CC/C=C/I)N3C)cc1 |
| InChI | InChI=1S/C20H26INO/c1-14-6-8-15(9-7-14)17-13-16-10-11-18(22(16)2)20(17)19(23)5-3-4-12-21/h4,6-9,12,16-18,20H,3,5,10-11,13H2,1-2H3/b12-4+/t16-,17+,18+,20-/m0/s1 |
| InChIKey | WPOWYXAYIRKXTG-NVDSVLOESA-N |
| XLogP | 4.86 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.34 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|