C17H18N2O3 — CID 101170049
ethyl 1-(2-oxopropyl)-1,9-dihydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 101170049) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is ethyl 1-(2-oxopropyl)-1,9-dihydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | ethyl 1-(2-oxopropyl)-1,9-dihydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 101170049 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | ethyl 1-(2-oxopropyl)-1,9-dihydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | CCOC(=O)N1C=Cc2c([nH]c3ccccc23)C1CC(C)=O |
| InChI | InChI=1S/C17H18N2O3/c1-3-22-17(21)19-9-8-13-12-6-4-5-7-14(12)18-16(13)15(19)10-11(2)20/h4-9,15,18H,3,10H2,1-2H3 |
| InChIKey | NUDXNMIZDCOENC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |