C12H10N2OS — CID 14379602
1-(9H-thiazino[6,5-b]indol-2-yl)ethanone (PubChem CID 14379602) has the molecular formula C12H10N2OS and a molecular weight of 230.29 g/mol. Its IUPAC name is 1-(9H-thiazino[6,5-b]indol-2-yl)ethanone.
| Compound Name | 1-(9H-thiazino[6,5-b]indol-2-yl)ethanone |
|---|---|
| PubChem CID | 14379602 |
| Molecular Formula | C12H10N2OS |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 1-(9H-thiazino[6,5-b]indol-2-yl)ethanone |
| SMILES | CC(=O)N1C=Cc2c([nH]c3ccccc23)S1 |
| InChI | InChI=1S/C12H10N2OS/c1-8(15)14-7-6-10-9-4-2-3-5-11(9)13-12(10)16-14/h2-7,13H,1H3 |
| InChIKey | RMQBAWTUWXJVOI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|