C25H18ClN5O4 — CID 10117127
1-[4-[(7-chloro-1,4,10-trioxo-3,5-dihydropyridazino[4,5-b]quinolin-2-yl)methyl]phenyl]-3-phenylurea (PubChem CID 10117127) has the molecular formula C25H18ClN5O4 and a molecular weight of 487.90 g/mol. Its IUPAC name is 1-[4-[(7-chloro-1,4,10-trioxo-3,5-dihydropyridazino[4,5-b]quinolin-2-yl)methyl]phenyl]-3-phenylurea.
| Compound Name | 1-[4-[(7-chloro-1,4,10-trioxo-3,5-dihydropyridazino[4,5-b]quinolin-2-yl)methyl]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 10117127 |
| Molecular Formula | C25H18ClN5O4 |
| Molecular Weight | 487.90 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | 1-[4-[(7-chloro-1,4,10-trioxo-3,5-dihydropyridazino[4,5-b]quinolin-2-yl)methyl]phenyl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)Nc1ccc(Cn2[nH]c(=O)c3[nH]c4cc(Cl)ccc4c(=O)c3c2=O)cc1 |
| InChI | InChI=1S/C25H18ClN5O4/c26-15-8-11-18-19(12-15)29-21-20(22(18)32)24(34)31(30-23(21)33)13-14-6-9-17(10-7-14)28-25(35)27-16-4-2-1-3-5-16/h1-12H,13H2,(H,29,32)(H,30,33)(H2,27,28,35) |
| InChIKey | JSNWSVCFUBFHCB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 128.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.90 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|