C21H16ClN3O5 — CID 10180799
methyl 4-[1-(7-chloro-1,4,10-trioxo-3,5-dihydropyridazino[4,5-b]quinolin-2-yl)ethyl]benzoate (PubChem CID 10180799) has the molecular formula C21H16ClN3O5 and a molecular weight of 425.83 g/mol. Its IUPAC name is methyl 4-[1-(7-chloro-1,4,10-trioxo-3,5-dihydropyridazino[4,5-b]quinolin-2-yl)ethyl]benzoate.
| Compound Name | methyl 4-[1-(7-chloro-1,4,10-trioxo-3,5-dihydropyridazino[4,5-b]quinolin-2-yl)ethyl]benzoate |
|---|---|
| PubChem CID | 10180799 |
| Molecular Formula | C21H16ClN3O5 |
| Molecular Weight | 425.83 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | methyl 4-[1-(7-chloro-1,4,10-trioxo-3,5-dihydropyridazino[4,5-b]quinolin-2-yl)ethyl]benzoate |
| SMILES | COC(=O)c1ccc(C(C)n2[nH]c(=O)c3[nH]c4cc(Cl)ccc4c(=O)c3c2=O)cc1 |
| InChI | InChI=1S/C21H16ClN3O5/c1-10(11-3-5-12(6-4-11)21(29)30-2)25-20(28)16-17(19(27)24-25)23-15-9-13(22)7-8-14(15)18(16)26/h3-10H,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | HPICEDZGJUHGKN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 114.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.83 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|