C18H12Cl2N4O3 — CID 91097737
7-chloro-2-[2-(2-chloro-3-pyridinyl)ethyl]-3,5-dihydropyridazino[4,5-b]quinoline-1,4,10-trione (PubChem CID 91097737) has the molecular formula C18H12Cl2N4O3 and a molecular weight of 403.23 g/mol. Its IUPAC name is 7-chloro-2-[2-(2-chloro-3-pyridinyl)ethyl]-3,5-dihydropyridazino[4,5-b]quinoline-1,4,10-trione.
| Compound Name | 7-chloro-2-[2-(2-chloro-3-pyridinyl)ethyl]-3,5-dihydropyridazino[4,5-b]quinoline-1,4,10-trione |
|---|---|
| PubChem CID | 91097737 |
| Molecular Formula | C18H12Cl2N4O3 |
| Molecular Weight | 403.23 g/mol |
| Exact Mass | 402.03 |
| IUPAC Name | 7-chloro-2-[2-(2-chloro-3-pyridinyl)ethyl]-3,5-dihydropyridazino[4,5-b]quinoline-1,4,10-trione |
| SMILES | O=c1[nH]n(CCc2cccnc2Cl)c(=O)c2c(=O)c3ccc(Cl)cc3[nH]c12 |
| InChI | InChI=1S/C18H12Cl2N4O3/c19-10-3-4-11-12(8-10)22-14-13(15(11)25)18(27)24(23-17(14)26)7-5-9-2-1-6-21-16(9)20/h1-4,6,8H,5,7H2,(H,22,25)(H,23,26) |
| InChIKey | JRLJTJXUFQJSQZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 100.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.23 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|