C18H10ClN3O4S — CID 23215621
O-[4-(7-chloro-1,4,10-trioxo-3,5-dihydropyridazino[4,5-b]quinolin-2-yl)phenyl] methanethioate (PubChem CID 23215621) has the molecular formula C18H10ClN3O4S and a molecular weight of 399.82 g/mol. Its IUPAC name is O-[4-(7-chloro-1,4,10-trioxo-3,5-dihydropyridazino[4,5-b]quinolin-2-yl)phenyl] methanethioate.
| Compound Name | O-[4-(7-chloro-1,4,10-trioxo-3,5-dihydropyridazino[4,5-b]quinolin-2-yl)phenyl] methanethioate |
|---|---|
| PubChem CID | 23215621 |
| Molecular Formula | C18H10ClN3O4S |
| Molecular Weight | 399.82 g/mol |
| Exact Mass | 399.01 |
| IUPAC Name | O-[4-(7-chloro-1,4,10-trioxo-3,5-dihydropyridazino[4,5-b]quinolin-2-yl)phenyl] methanethioate |
| SMILES | O=c1[nH]n(-c2ccc(OC=S)cc2)c(=O)c2c(=O)c3ccc(Cl)cc3[nH]c12 |
| InChI | InChI=1S/C18H10ClN3O4S/c19-9-1-6-12-13(7-9)20-15-14(16(12)23)18(25)22(21-17(15)24)10-2-4-11(5-3-10)26-8-27/h1-8H,(H,20,23)(H,21,24) |
| InChIKey | GXKZYPKMEPSUIC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.82 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|