C18H10ClN3O5S — CID 23215624
7-chloro-2-[4-(sulfonylmethyl)phenyl]-3,5-dihydropyridazino[4,5-b]quinoline-1,4,10-trione (PubChem CID 23215624) has the molecular formula C18H10ClN3O5S and a molecular weight of 415.81 g/mol. Its IUPAC name is 7-chloro-2-[4-(sulfonylmethyl)phenyl]-3,5-dihydropyridazino[4,5-b]quinoline-1,4,10-trione.
| Compound Name | 7-chloro-2-[4-(sulfonylmethyl)phenyl]-3,5-dihydropyridazino[4,5-b]quinoline-1,4,10-trione |
|---|---|
| PubChem CID | 23215624 |
| Molecular Formula | C18H10ClN3O5S |
| Molecular Weight | 415.81 g/mol |
| Exact Mass | 415.00 |
| IUPAC Name | 7-chloro-2-[4-(sulfonylmethyl)phenyl]-3,5-dihydropyridazino[4,5-b]quinoline-1,4,10-trione |
| SMILES | O=c1[nH]n(-c2ccc(C=S(=O)=O)cc2)c(=O)c2c(=O)c3ccc(Cl)cc3[nH]c12 |
| InChI | InChI=1S/C18H10ClN3O5S/c19-10-3-6-12-13(7-10)20-15-14(16(12)23)18(25)22(21-17(15)24)11-4-1-9(2-5-11)8-28(26)27/h1-8H,(H,20,23)(H,21,24) |
| InChIKey | ZITMRDHUZCFXTI-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 121.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.81 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|