C19H13ClN3NaO4 — CID 23697239
sodium 7-chloro-2-(4-methoxy-2-methylphenyl)-1,10-dioxo-5H-pyridazino[4,5-b]quinolin-4-olate (PubChem CID 23697239) has the molecular formula C19H13ClN3NaO4 and a molecular weight of 405.77 g/mol. Its IUPAC name is sodium 7-chloro-2-(4-methoxy-2-methylphenyl)-1,10-dioxo-5H-pyridazino[4,5-b]quinolin-4-olate.
| Compound Name | sodium 7-chloro-2-(4-methoxy-2-methylphenyl)-1,10-dioxo-5H-pyridazino[4,5-b]quinolin-4-olate |
|---|---|
| PubChem CID | 23697239 |
| Molecular Formula | C19H13ClN3NaO4 |
| Molecular Weight | 405.77 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | sodium 7-chloro-2-(4-methoxy-2-methylphenyl)-1,10-dioxo-5H-pyridazino[4,5-b]quinolin-4-olate |
| SMILES | COc1ccc(-n2nc([O-])c3[nH]c4cc(Cl)ccc4c(=O)c3c2=O)c(C)c1.[Na+] |
| InChI | InChI=1S/C19H14ClN3O4.Na/c1-9-7-11(27-2)4-6-14(9)23-19(26)15-16(18(25)22-23)21-13-8-10(20)3-5-12(13)17(15)24;/h3-8H,1-2H3,(H,21,24)(H,22,25);/q;+1/p-1 |
| InChIKey | BRZZJWQVXFMHIU-UHFFFAOYSA-M |
| XLogP | -0.72 |
| TPSA | 100.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.77 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|